C20H23N6O2+ — CID 7407339
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 7407339) has the molecular formula C20H23N6O2+ and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 7407339 |
| Molecular Formula | C20H23N6O2+ |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | c1nc2nc3c(c(N4CC[NH+](Cc5ccc6c(c5)OCO6)CC4)n2n1)CCC3 |
| InChI | InChI=1S/C20H22N6O2/c1-2-15-16(3-1)23-20-21-12-22-26(20)19(15)25-8-6-24(7-9-25)11-14-4-5-17-18(10-14)28-13-27-17/h4-5,10,12H,1-3,6-9,11,13H2/p+1 |
| InChIKey | XXMUTLGZCAORES-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |