C22H30N2O4S — CID 7418709
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7418709) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7418709 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)NC(=O)NC23CC4CC(CC(C4)C2)C3)sc1C |
| InChI | InChI=1S/C22H30N2O4S/c1-3-4-17-8-18(29-13(17)2)20(26)28-12-19(25)23-21(27)24-22-9-14-5-15(10-22)7-16(6-14)11-22/h8,14-16H,3-7,9-12H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | GGTBXDCIQZURSL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |