C20H19F3N2O2S — CID 74227857
5-(dimethylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]naphthalene-1-sulfonamide (PubChem CID 74227857) has the molecular formula C20H19F3N2O2S and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 74227857 |
| Molecular Formula | C20H19F3N2O2S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-(dimethylamino)-N-[[2-(trifluoromethyl)phenyl]methyl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCc3ccccc3C(F)(F)F)cccc12 |
| InChI | InChI=1S/C20H19F3N2O2S/c1-25(2)18-11-5-9-16-15(18)8-6-12-19(16)28(26,27)24-13-14-7-3-4-10-17(14)20(21,22)23/h3-12,24H,13H2,1-2H3 |
| InChIKey | PEDROZCGOIBHRV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |