C20H22N2O3S — CID 7429998
(5S)-N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7429998) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (5S)-N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7429998 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (5S)-N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@H]1CCc2sc(C(=O)N/N=C(/C)c3ccc4c(c3)OCO4)cc2C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-13-4-7-18-15(8-13)10-19(26-18)20(23)22-21-12(2)14-5-6-16-17(9-14)25-11-24-16/h5-6,9-10,13H,3-4,7-8,11H2,1-2H3,(H,22,23)/b21-12-/t13-/m0/s1 |
| InChIKey | LJYJLCOUNZUTRQ-KUARTLJMSA-N |
| XLogP | 4.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|