About methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate
methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate (PubChem CID 74317113) has the molecular formula C13H25NO5
and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate |
| PubChem CID | 74317113 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate |
| SMILES | COC(=O)C(NCCC1OCC(C)(C)CO1)C(C)O |
| InChI | InChI=1S/C13H25NO5/c1-9(15)11(12(16)17-4)14-6-5-10-18-7-13(2,3)8-19-10/h9-11,14-15H,5-8H2,1-4H3 |
| InChIKey | ALTNZBNKMXPEDC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate?
The IUPAC name of methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate (CID 74317113) is methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate.
What is the SMILES notation for methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate?
The canonical SMILES for methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate is COC(=O)C(NCCC1OCC(C)(C)CO1)C(C)O.
What is the InChIKey of methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate?
The InChIKey is ALTNZBNKMXPEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5/c1-9(15)11(12(16)17-4)14-6-5-10-18-7-13(2,3)8-19-10/h9-11,14-15H,5-8H2,1-4H3.
What are the key properties of methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate?
methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate has a molecular weight of 275.35 g/mol, XLogP of 0.29, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-hydroxybutanoate is sourced from PubChem (CID 74317113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).