C13H22O5 — CID 54530313
2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethoxy]ethyl prop-2-enoate (PubChem CID 54530313) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 54530313 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H22O5/c1-4-11(14)16-8-7-15-6-5-12-17-9-13(2,3)10-18-12/h4,12H,1,5-10H2,2-3H3 |
| InChIKey | YWBCPQZKMHMPIJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|