C21H31N3O3 — CID 7431757
1,3-dicyclohexyl-5-(N-cyclopropyl-C-methylcarbonimidoyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7431757) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-(N-cyclopropyl-C-methylcarbonimidoyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-(N-cyclopropyl-C-methylcarbonimidoyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7431757 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1,3-dicyclohexyl-5-(N-cyclopropyl-C-methylcarbonimidoyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C/C(=N\C1CC1)C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H31N3O3/c1-14(22-15-12-13-15)18-19(25)23(16-8-4-2-5-9-16)21(27)24(20(18)26)17-10-6-3-7-11-17/h15-18H,2-13H2,1H3/b22-14+ |
| InChIKey | GYISYZUPXDKKPO-HYARGMPZSA-N |
| XLogP | 3.68 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|