C20H25N3O4 — CID 7433778
(2S,3S,4R,5R,6R)-2-methyl-6-[4-methyl-2-[(4-methylphenyl)diazenyl]anilino]oxane-3,4,5-triol (PubChem CID 7433778) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-methyl-6-[4-methyl-2-[(4-methylphenyl)diazenyl]anilino]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6R)-2-methyl-6-[4-methyl-2-[(4-methylphenyl)diazenyl]anilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7433778 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-methyl-6-[4-methyl-2-[(4-methylphenyl)diazenyl]anilino]oxane-3,4,5-triol |
| SMILES | Cc1ccc(/N=N/c2cc(C)ccc2N[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-11-4-7-14(8-5-11)22-23-16-10-12(2)6-9-15(16)21-20-19(26)18(25)17(24)13(3)27-20/h4-10,13,17-21,24-26H,1-3H3/b23-22+/t13-,17+,18+,19+,20+/m0/s1 |
| InChIKey | YFPIVGOSXSIEFG-RORJYTCGSA-N |
| XLogP | 2.96 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|