C21H20N4O5S2 — CID 74394106
4-[[2-[4-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid (PubChem CID 74394106) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[2-[4-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid.
| Compound Name | 4-[[2-[4-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 74394106 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 4-[[2-[4-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
| SMILES | O=C(O)CC(NC(=O)CS)C(=O)NCC(=O)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H20N4O5S2/c26-17(10-22-20(30)15(9-19(28)29)24-18(27)11-31)23-13-7-5-12(6-8-13)21-25-14-3-1-2-4-16(14)32-21/h1-8,15,31H,9-11H2,(H,22,30)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | IHNLZGAQXWYAAA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|