C21H27ClN3+ — CID 7440950
4-[(E)-3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]prop-1-enyl]-N,N-dimethylaniline (PubChem CID 7440950) has the molecular formula C21H27ClN3+ and a molecular weight of 356.92 g/mol. Its IUPAC name is 4-[(E)-3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]prop-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]prop-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7440950 |
| Molecular Formula | C21H27ClN3+ |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 4-[(E)-3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]prop-1-enyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C[NH+]2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26ClN3/c1-23(2)20-10-8-18(9-11-20)5-4-12-24-13-15-25(16-14-24)21-7-3-6-19(22)17-21/h3-11,17H,12-16H2,1-2H3/p+1/b5-4+ |
| InChIKey | UCLMSDMQRMSBKB-SNAWJCMRSA-O |
| XLogP | 2.82 |
| TPSA | 10.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|