C14H23N3O5 — CID 74419566
1-(3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl)-3-prop-2-enylurea (PubChem CID 74419566) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-(3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl)-3-prop-2-enylurea.
| Compound Name | 1-(3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 74419566 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-(3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC1C2COC(O2)C(N2CCOCC2)C1O |
| InChI | InChI=1S/C14H23N3O5/c1-2-3-15-14(19)16-10-9-8-21-13(22-9)11(12(10)18)17-4-6-20-7-5-17/h2,9-13,18H,1,3-8H2,(H2,15,16,19) |
| InChIKey | VDTOFIAWBIWPET-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|