C24H22NO5- — CID 7447195
4-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-[(E)-2-phenylethenyl]pyrrolidin-1-yl]butanoate (PubChem CID 7447195) has the molecular formula C24H22NO5- and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-[(E)-2-phenylethenyl]pyrrolidin-1-yl]butanoate.
| Compound Name | 4-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-[(E)-2-phenylethenyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 7447195 |
| Molecular Formula | C24H22NO5- |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[(5S)-4-[hydroxy-(4-methylphenyl)methylidene]-2,3-dioxo-5-[(E)-2-phenylethenyl]pyrrolidin-1-yl]butanoate |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(CCCC(=O)[O-])[C@H]2/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO5/c1-16-9-12-18(13-10-16)22(28)21-19(14-11-17-6-3-2-4-7-17)25(24(30)23(21)29)15-5-8-20(26)27/h2-4,6-7,9-14,19,28H,5,8,15H2,1H3,(H,26,27)/p-1/b14-11+,22-21?/t19-/m0/s1 |
| InChIKey | LEQKBZDBWNQATE-ZXCURROGSA-M |
| XLogP | 2.29 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|