C17H31N — CID 7451913
(E,2S)-N-butyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine (PubChem CID 7451913) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (E,2S)-N-butyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine.
| Compound Name | (E,2S)-N-butyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine |
|---|---|
| PubChem CID | 7451913 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (E,2S)-N-butyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine |
| SMILES | CCCCN[C@@H](C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C17H31N/c1-6-7-13-18-15(3)10-11-16-14(2)9-8-12-17(16,4)5/h10-11,15,18H,6-9,12-13H2,1-5H3/b11-10+/t15-/m0/s1 |
| InChIKey | MQSYMRRWRYOKJA-NKSUMMKUSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|