C11H17N6O3+ — CID 74526043
2-[1,3-dimethyl-8-(methylamino)-2,6-dioxo-5H-purin-7-ium-7-yl]-N-methylacetamide (PubChem CID 74526043) has the molecular formula C11H17N6O3+ and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-[1,3-dimethyl-8-(methylamino)-2,6-dioxo-5H-purin-7-ium-7-yl]-N-methylacetamide.
| Compound Name | 2-[1,3-dimethyl-8-(methylamino)-2,6-dioxo-5H-purin-7-ium-7-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 74526043 |
| Molecular Formula | C11H17N6O3+ |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[1,3-dimethyl-8-(methylamino)-2,6-dioxo-5H-purin-7-ium-7-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[N+]1=C(NC)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H16N6O3/c1-12-6(18)5-17-7-8(14-10(17)13-2)15(3)11(20)16(4)9(7)19/h7H,5H2,1-4H3,(H,12,18)/p+1 |
| InChIKey | CSLUTVABKZUDRO-UHFFFAOYSA-O |
| XLogP | -2.38 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|