C12H19N4O2S+ — CID 74526121
7-ethyl-1,3-dimethyl-8-propan-2-ylsulfanyl-5H-purin-7-ium-2,6-dione (PubChem CID 74526121) has the molecular formula C12H19N4O2S+ and a molecular weight of 283.38 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-propan-2-ylsulfanyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-propan-2-ylsulfanyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74526121 |
| Molecular Formula | C12H19N4O2S+ |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-propan-2-ylsulfanyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC[N+]1=C(SC(C)C)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C12H19N4O2S/c1-6-16-8-9(13-11(16)19-7(2)3)14(4)12(18)15(5)10(8)17/h7-8H,6H2,1-5H3/q+1 |
| InChIKey | BZGRAMIIYXESCT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|