C10H11N4O4S+ — CID 73257424
2-(4-methyl-1,3-dioxo-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-2-yl)acetic acid (PubChem CID 73257424) has the molecular formula C10H11N4O4S+ and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-(4-methyl-1,3-dioxo-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-2-yl)acetic acid.
| Compound Name | 2-(4-methyl-1,3-dioxo-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-2-yl)acetic acid |
|---|---|
| PubChem CID | 73257424 |
| Molecular Formula | C10H11N4O4S+ |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(4-methyl-1,3-dioxo-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-2-yl)acetic acid |
| SMILES | CN1C(=O)N(CC(=O)O)C(=O)C2C1=NC1=[N+]2CCS1 |
| InChI | InChI=1S/C10H10N4O4S/c1-12-7-6(13-2-3-19-9(13)11-7)8(17)14(10(12)18)4-5(15)16/h6H,2-4H2,1H3/p+1 |
| InChIKey | YBLQBRHWGAAQBO-UHFFFAOYSA-O |
| XLogP | -1.14 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|