C13H19N4O5S+ — CID 72727445
ethyl 2-[[9-(2-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-9-ium-8-yl]sulfanyl]acetate (PubChem CID 72727445) has the molecular formula C13H19N4O5S+ and a molecular weight of 343.39 g/mol. Its IUPAC name is ethyl 2-[[9-(2-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-9-ium-8-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[9-(2-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-9-ium-8-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 72727445 |
| Molecular Formula | C13H19N4O5S+ |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 2-[[9-(2-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-9-ium-8-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSC1=NC2C(=O)N(C)C(=O)N(C)C2=[N+]1CCO |
| InChI | InChI=1S/C13H19N4O5S/c1-4-22-8(19)7-23-12-14-9-10(17(12)5-6-18)15(2)13(21)16(3)11(9)20/h9,18H,4-7H2,1-3H3/q+1 |
| InChIKey | SKDCBTOTBFYTRH-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|