C13H17N4O4S+ — CID 74157352
ethyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate (PubChem CID 74157352) has the molecular formula C13H17N4O4S+ and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate.
| Compound Name | ethyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate |
|---|---|
| PubChem CID | 74157352 |
| Molecular Formula | C13H17N4O4S+ |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(=NC3=[N+]2CCCS3)N(C)C1=O |
| InChI | InChI=1S/C13H17N4O4S/c1-3-21-8(18)7-17-11(19)9-10(15(2)13(17)20)14-12-16(9)5-4-6-22-12/h9H,3-7H2,1-2H3/q+1 |
| InChIKey | QZIWBMIVKBIFHN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|