C17H25N6O5S+ — CID 73327343
ethyl 4-[2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetyl]piperazine-1-carboxylate (PubChem CID 73327343) has the molecular formula C17H25N6O5S+ and a molecular weight of 425.49 g/mol. Its IUPAC name is ethyl 4-[2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 73327343 |
| Molecular Formula | C17H25N6O5S+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 4-[2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CSC2=NC3C(=O)N(C)C(=O)N(C)C3=[N+]2C)CC1 |
| InChI | InChI=1S/C17H25N6O5S/c1-5-28-17(27)23-8-6-22(7-9-23)11(24)10-29-15-18-12-13(19(15)2)20(3)16(26)21(4)14(12)25/h12H,5-10H2,1-4H3/q+1 |
| InChIKey | QRYGEMHKEHWSQC-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|