C14H21N4O4S+ — CID 74526081
propyl 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate (PubChem CID 74526081) has the molecular formula C14H21N4O4S+ and a molecular weight of 341.41 g/mol. Its IUPAC name is propyl 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate.
| Compound Name | propyl 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 74526081 |
| Molecular Formula | C14H21N4O4S+ |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | propyl 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate |
| SMILES | CCCOC(=O)CSC1=[N+](CC)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C14H21N4O4S/c1-5-7-22-9(19)8-23-13-15-11-10(18(13)6-2)12(20)17(4)14(21)16(11)3/h10H,5-8H2,1-4H3/q+1 |
| InChIKey | CABAZAFIAGZTDN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|