C24H28BrN3O4 — CID 74531955
1-[(4-bromophenyl)methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 74531955) has the molecular formula C24H28BrN3O4 and a molecular weight of 502.41 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 74531955 |
| Molecular Formula | C24H28BrN3O4 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(CCN2C(=O)C3NCCCC3N(Cc3ccc(Br)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C24H28BrN3O4/c1-31-20-10-7-16(14-21(20)32-2)11-13-27-23(29)22-19(4-3-12-26-22)28(24(27)30)15-17-5-8-18(25)9-6-17/h5-10,14,19,22,26H,3-4,11-13,15H2,1-2H3 |
| InChIKey | LCSBGVQTZBDLNY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |