C26H28F2N2O5 — CID 74539447
2-[[3-fluoro-8-[(2-fluoro-6-nitrophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 74539447) has the molecular formula C26H28F2N2O5 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[[3-fluoro-8-[(2-fluoro-6-nitrophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-[[3-fluoro-8-[(2-fluoro-6-nitrophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 74539447 |
| Molecular Formula | C26H28F2N2O5 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[[3-fluoro-8-[(2-fluoro-6-nitrophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1(F)CC3CCC(C1)N3Cc1c(F)cccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C26H28F2N2O5/c1-34-23-9-15-8-16(25(31)19(15)10-24(23)35-2)11-26(28)12-17-6-7-18(13-26)29(17)14-20-21(27)4-3-5-22(20)30(32)33/h3-5,9-10,16-18H,6-8,11-14H2,1-2H3 |
| InChIKey | INLSXDWDCUOBBY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|