C13H19N6O2+ — CID 74562618
1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]purin-3-ium-2,6-dione (PubChem CID 74562618) has the molecular formula C13H19N6O2+ and a molecular weight of 291.33 g/mol. Its IUPAC name is 1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]purin-3-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]purin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 74562618 |
| Molecular Formula | C13H19N6O2+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]purin-3-ium-2,6-dione |
| SMILES | CN1CCN(CC2=NC3=[N+](C)C(=O)N(C)C(=O)C3=N2)CC1 |
| InChI | InChI=1S/C13H19N6O2/c1-16-4-6-19(7-5-16)8-9-14-10-11(15-9)17(2)13(21)18(3)12(10)20/h4-8H2,1-3H3/q+1 |
| InChIKey | VBRQVHIFPFCXJL-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|