C14H21N6O2+ — CID 74562634
8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 74562634) has the molecular formula C14H21N6O2+ and a molecular weight of 305.36 g/mol. Its IUPAC name is 8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethylpurin-3-ium-2,6-dione.
| Compound Name | 8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 74562634 |
| Molecular Formula | C14H21N6O2+ |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 8-[(4-ethylpiperazin-1-yl)methyl]-1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CCN1CCN(CC2=NC3=[N+](C)C(=O)N(C)C(=O)C3=N2)CC1 |
| InChI | InChI=1S/C14H21N6O2/c1-4-19-5-7-20(8-6-19)9-10-15-11-12(16-10)17(2)14(22)18(3)13(11)21/h4-9H2,1-3H3/q+1 |
| InChIKey | DLBWPZKYFCYQND-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|