C18H26N2O4 — CID 74576696
2-[3-ethyl-1-(furan-2-carbonyl)piperidin-4-yl]-1-morpholin-4-ylethanone (PubChem CID 74576696) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[3-ethyl-1-(furan-2-carbonyl)piperidin-4-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[3-ethyl-1-(furan-2-carbonyl)piperidin-4-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 74576696 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[3-ethyl-1-(furan-2-carbonyl)piperidin-4-yl]-1-morpholin-4-ylethanone |
| SMILES | CCC1CN(C(=O)c2ccco2)CCC1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-14-13-20(18(22)16-4-3-9-24-16)6-5-15(14)12-17(21)19-7-10-23-11-8-19/h3-4,9,14-15H,2,5-8,10-13H2,1H3 |
| InChIKey | KIHCPRAWBCEYHC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |