C19H27NO3S — CID 74627750
4-methyl-N-(3-methyl-2-methylidenebutyl)-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide (PubChem CID 74627750) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-2-methylidenebutyl)-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-methyl-2-methylidenebutyl)-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 74627750 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 4-methyl-N-(3-methyl-2-methylidenebutyl)-N-[(1-methyl-3-oxocyclobutyl)methyl]benzenesulfonamide |
| SMILES | C=C(CN(CC1(C)CC(=O)C1)S(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C19H27NO3S/c1-14(2)16(4)12-20(13-19(5)10-17(21)11-19)24(22,23)18-8-6-15(3)7-9-18/h6-9,14H,4,10-13H2,1-3,5H3 |
| InChIKey | XAKCGOWEAOIYRJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|