C16H24N5O3+ — CID 74688459
7-[3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74688459) has the molecular formula C16H24N5O3+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 7-[3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74688459 |
| Molecular Formula | C16H24N5O3+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 7-[3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CCN(CC=C)CC(O)C[N+]1=CN=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H24N5O3/c1-5-7-20(8-6-2)9-12(22)10-21-11-17-14-13(21)15(23)19(4)16(24)18(14)3/h5-6,11-13,22H,1-2,7-10H2,3-4H3/q+1 |
| InChIKey | ICNNEIIYLXKIBL-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|