C10H14BrN4O3+ — CID 76845709
8-bromo-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 76845709) has the molecular formula C10H14BrN4O3+ and a molecular weight of 318.15 g/mol. Its IUPAC name is 8-bromo-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 76845709 |
| Molecular Formula | C10H14BrN4O3+ |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 8-bromo-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC(O)C[N+]1=C(Br)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C10H14BrN4O3/c1-5(16)4-15-6-7(12-9(15)11)13(2)10(18)14(3)8(6)17/h5-6,16H,4H2,1-3H3/q+1 |
| InChIKey | UDGSKXPZVBHEIG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|