C10H13N4O3+ — CID 74502748
1,3-dimethyl-7-(oxiran-2-ylmethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74502748) has the molecular formula C10H13N4O3+ and a molecular weight of 237.24 g/mol. Its IUPAC name is 1,3-dimethyl-7-(oxiran-2-ylmethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(oxiran-2-ylmethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74502748 |
| Molecular Formula | C10H13N4O3+ |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1,3-dimethyl-7-(oxiran-2-ylmethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC2CO2)N(C)C1=O |
| InChI | InChI=1S/C10H13N4O3/c1-12-8-7(9(15)13(2)10(12)16)14(5-11-8)3-6-4-17-6/h5-7H,3-4H2,1-2H3/q+1 |
| InChIKey | RRDOLZNTXDQLHT-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 68.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|