C18H28N5O4+ — CID 74562776
8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 74562776) has the molecular formula C18H28N5O4+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74562776 |
| Molecular Formula | C18H28N5O4+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)C(C)[N+]1=C(CN2CC(C)OC(C)C2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H28N5O4/c1-10-7-22(8-11(2)27-10)9-14-19-16-15(23(14)12(3)13(4)24)17(25)21(6)18(26)20(16)5/h10-12,15H,7-9H2,1-6H3/q+1 |
| InChIKey | WQWNSLRQCLJENE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|