C12H17N4O3+ — CID 75609011
8-(1-hydroxyethyl)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 75609011) has the molecular formula C12H17N4O3+ and a molecular weight of 265.29 g/mol. Its IUPAC name is 8-(1-hydroxyethyl)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(1-hydroxyethyl)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75609011 |
| Molecular Formula | C12H17N4O3+ |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 8-(1-hydroxyethyl)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1=C(C(C)O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C12H17N4O3/c1-5-6-16-8-10(13-9(16)7(2)17)14(3)12(19)15(4)11(8)18/h5,7-8,17H,1,6H2,2-4H3/q+1 |
| InChIKey | HJMYEQCAVWYCQT-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|