C13H16BrN4O3+ — CID 74776475
8-bromo-3-methyl-7-(3-oxobutan-2-yl)-1-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 74776475) has the molecular formula C13H16BrN4O3+ and a molecular weight of 356.20 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-(3-oxobutan-2-yl)-1-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-(3-oxobutan-2-yl)-1-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74776475 |
| Molecular Formula | C13H16BrN4O3+ |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 8-bromo-3-methyl-7-(3-oxobutan-2-yl)-1-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CCN1C(=O)C2C(=NC(Br)=[N+]2C(C)C(C)=O)N(C)C1=O |
| InChI | InChI=1S/C13H16BrN4O3/c1-5-6-17-11(20)9-10(16(4)13(17)21)15-12(14)18(9)7(2)8(3)19/h5,7,9H,1,6H2,2-4H3/q+1 |
| InChIKey | PIENSGXVZIAQCD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|