C12H16N5O3+ — CID 75609001
3-[8-(1-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]propanenitrile (PubChem CID 75609001) has the molecular formula C12H16N5O3+ and a molecular weight of 278.29 g/mol. Its IUPAC name is 3-[8-(1-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]propanenitrile.
| Compound Name | 3-[8-(1-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]propanenitrile |
|---|---|
| PubChem CID | 75609001 |
| Molecular Formula | C12H16N5O3+ |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[8-(1-hydroxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]propanenitrile |
| SMILES | CC(O)C1=[N+](CCC#N)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C12H16N5O3/c1-7(18)9-14-10-8(17(9)6-4-5-13)11(19)16(3)12(20)15(10)2/h7-8,18H,4,6H2,1-3H3/q+1 |
| InChIKey | XDKPBMBKNQDVSZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|