C14H23N6O3+ — CID 74570656
7-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 74570656) has the molecular formula C14H23N6O3+ and a molecular weight of 323.38 g/mol. Its IUPAC name is 7-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74570656 |
| Molecular Formula | C14H23N6O3+ |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 7-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CN2CCN(CCO)CC2)N(C)C1=O |
| InChI | InChI=1S/C14H23N6O3/c1-16-12-11(13(22)17(2)14(16)23)20(9-15-12)10-19-5-3-18(4-6-19)7-8-21/h9,11,21H,3-8,10H2,1-2H3/q+1 |
| InChIKey | PBQIXABKIWEBKU-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|