C7H6N4O2S — CID 74721748
3-methyl-2-sulfanylidene-4a,8-dihydropteridine-4,7-dione (PubChem CID 74721748) has the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-methyl-2-sulfanylidene-4a,8-dihydropteridine-4,7-dione.
| Compound Name | 3-methyl-2-sulfanylidene-4a,8-dihydropteridine-4,7-dione |
|---|---|
| PubChem CID | 74721748 |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3-methyl-2-sulfanylidene-4a,8-dihydropteridine-4,7-dione |
| SMILES | CN1C(=O)C2N=CC(=O)NC2=NC1=S |
| InChI | InChI=1S/C7H6N4O2S/c1-11-6(13)4-5(10-7(11)14)9-3(12)2-8-4/h2,4H,1H3,(H,9,10,12,14) |
| InChIKey | UTAVYDHFAJIWKY-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|