C13H21N3O3 — CID 7474507
5-(C-ethyl-N-hexylcarbonimidoyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7474507) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-(C-ethyl-N-hexylcarbonimidoyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(C-ethyl-N-hexylcarbonimidoyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7474507 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-(C-ethyl-N-hexylcarbonimidoyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCC/N=C(\CC)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C13H21N3O3/c1-3-5-6-7-8-14-9(4-2)10-11(17)15-13(19)16-12(10)18/h10H,3-8H2,1-2H3,(H2,15,16,17,18,19)/b14-9+ |
| InChIKey | IKMSSADJPVZCKK-NTEUORMPSA-N |
| XLogP | 1.40 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|