About 2-azaniumylethylazanium;phthalate
2-azaniumylethylazanium;phthalate (PubChem CID 74765933) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-azaniumylethylazanium;phthalate.
Molecular Properties
| Compound Name | 2-azaniumylethylazanium;phthalate |
| PubChem CID | 74765933 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-azaniumylethylazanium;phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[NH3+]CC[NH3+] |
| InChI | InChI=1S/C8H6O4.C2H8N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;3-1-2-4/h1-4H,(H,9,10)(H,11,12);1-4H2 |
| InChIKey | XQKALXBRQOSLBI-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-azaniumylethylazanium;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethylazanium;phthalate?
The IUPAC name of 2-azaniumylethylazanium;phthalate (CID 74765933) is 2-azaniumylethylazanium;phthalate.
What is the SMILES notation for 2-azaniumylethylazanium;phthalate?
The canonical SMILES for 2-azaniumylethylazanium;phthalate is O=C([O-])c1ccccc1C(=O)[O-].[NH3+]CC[NH3+].
What is the InChIKey of 2-azaniumylethylazanium;phthalate?
The InChIKey is XQKALXBRQOSLBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C2H8N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;3-1-2-4/h1-4H,(H,9,10)(H,11,12);1-4H2.
What are the key properties of 2-azaniumylethylazanium;phthalate?
2-azaniumylethylazanium;phthalate has a molecular weight of 226.23 g/mol, XLogP of -4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethylazanium;phthalate is sourced from PubChem (CID 74765933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).