C15H22N5O4+ — CID 74776528
2-[1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-2,6-dioxo-5H-purin-7-yl]acetic acid (PubChem CID 74776528) has the molecular formula C15H22N5O4+ and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-2,6-dioxo-5H-purin-7-yl]acetic acid.
| Compound Name | 2-[1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-2,6-dioxo-5H-purin-7-yl]acetic acid |
|---|---|
| PubChem CID | 74776528 |
| Molecular Formula | C15H22N5O4+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[1,3-dimethyl-8-(3-methylpiperidin-1-ium-1-ylidene)-2,6-dioxo-5H-purin-7-yl]acetic acid |
| SMILES | CC1CCC/[N+](=C2/N=C3C(C(=O)N(C)C(=O)N3C)N2CC(=O)O)C1 |
| InChI | InChI=1S/C15H21N5O4/c1-9-5-4-6-19(7-9)14-16-12-11(20(14)8-10(21)22)13(23)18(3)15(24)17(12)2/h9,11H,4-8H2,1-3H3/p+1 |
| InChIKey | XBDHYLIGJXUGPL-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|