C20H29ClN2O3 — CID 74895417
2-(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-2-ium-1-ylidene)-1-piperidin-1-ylethanone chloride (PubChem CID 74895417) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-2-ium-1-ylidene)-1-piperidin-1-ylethanone chloride.
| Compound Name | 2-(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-2-ium-1-ylidene)-1-piperidin-1-ylethanone chloride |
|---|---|
| PubChem CID | 74895417 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-(6,7-dimethoxy-3,3-dimethyl-2,4-dihydroisoquinolin-2-ium-1-ylidene)-1-piperidin-1-ylethanone chloride |
| SMILES | COc1cc2c(cc1OC)C(=CC(=O)N1CCCCC1)[NH2+]C(C)(C)C2.[Cl-] |
| InChI | InChI=1S/C20H28N2O3.ClH/c1-20(2)13-14-10-17(24-3)18(25-4)11-15(14)16(21-20)12-19(23)22-8-6-5-7-9-22;/h10-12,21H,5-9,13H2,1-4H3;1H |
| InChIKey | QVRHHLYUKWXKOU-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|