C18H30N3O3+ — CID 7496089
[(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethoxy-4-oxobutanoyl)amino]ethyl]-dimethylazanium (PubChem CID 7496089) has the molecular formula C18H30N3O3+ and a molecular weight of 336.46 g/mol. Its IUPAC name is [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethoxy-4-oxobutanoyl)amino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethoxy-4-oxobutanoyl)amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7496089 |
| Molecular Formula | C18H30N3O3+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethoxy-4-oxobutanoyl)amino]ethyl]-dimethylazanium |
| SMILES | CCOC(=O)CCC(=O)NC[C@@H](c1ccc(N(C)C)cc1)[NH+](C)C |
| InChI | InChI=1S/C18H29N3O3/c1-6-24-18(23)12-11-17(22)19-13-16(21(4)5)14-7-9-15(10-8-14)20(2)3/h7-10,16H,6,11-13H2,1-5H3,(H,19,22)/p+1/t16-/m0/s1 |
| InChIKey | YMFFLQQJMGGVTP-INIZCTEOSA-O |
| XLogP | 0.40 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|