C25H34N3O3+ — CID 7497721
ethyl 4-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]amino]-4-oxobutanoate (PubChem CID 7497721) has the molecular formula C25H34N3O3+ and a molecular weight of 424.57 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7497721 |
| Molecular Formula | C25H34N3O3+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | ethyl 4-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC[C@H](c1ccc(N(C)C)cc1)[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H33N3O3/c1-4-31-25(30)14-13-24(29)26-17-23(20-9-11-22(12-10-20)27(2)3)28-16-15-19-7-5-6-8-21(19)18-28/h5-12,23H,4,13-18H2,1-3H3,(H,26,29)/p+1/t23-/m1/s1 |
| InChIKey | YUPHEZQLKFKWSG-HSZRJFAPSA-O |
| XLogP | 1.89 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|