C22H30FN4O2+ — CID 7497487
methyl N-[(2S)-2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]ethyl]carbamate (PubChem CID 7497487) has the molecular formula C22H30FN4O2+ and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl N-[(2S)-2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[(2S)-2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 7497487 |
| Molecular Formula | C22H30FN4O2+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | methyl N-[(2S)-2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]ethyl]carbamate |
| SMILES | COC(=O)NC[C@H](c1ccc(N(C)C)cc1)[NH+]1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H29FN4O2/c1-25(2)19-8-4-17(5-9-19)21(16-24-22(28)29-3)27-14-12-26(13-15-27)20-10-6-18(23)7-11-20/h4-11,21H,12-16H2,1-3H3,(H,24,28)/p+1/t21-/m1/s1 |
| InChIKey | XKZSFDPVRJOFEY-OAQYLSRUSA-O |
| XLogP | 1.69 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|