C19H18Cl2O2 — CID 75081705
3-[4-[(3,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-en-1-ol (PubChem CID 75081705) has the molecular formula C19H18Cl2O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is 3-[4-[(3,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-en-1-ol.
| Compound Name | 3-[4-[(3,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 75081705 |
| Molecular Formula | C19H18Cl2O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[4-[(3,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-en-1-ol |
| SMILES | C=CCc1cc(C=CCO)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2O2/c1-2-4-16-11-14(5-3-10-22)7-9-19(16)23-13-15-6-8-17(20)18(21)12-15/h2-3,5-9,11-12,22H,1,4,10,13H2 |
| InChIKey | GCJWPNKJZHVCRI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|