C22H18N2O6 — CID 75093511
13,14-dihydroxy-12-(hydroxymethyl)-9-(1H-indol-3-yl)-11-oxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,15-dione (PubChem CID 75093511) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is 13,14-dihydroxy-12-(hydroxymethyl)-9-(1H-indol-3-yl)-11-oxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,15-dione.
| Compound Name | 13,14-dihydroxy-12-(hydroxymethyl)-9-(1H-indol-3-yl)-11-oxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,15-dione |
|---|---|
| PubChem CID | 75093511 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 13,14-dihydroxy-12-(hydroxymethyl)-9-(1H-indol-3-yl)-11-oxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,15-dione |
| SMILES | O=C1N2c3ccccc3C(=O)C2(c2c[nH]c3ccccc23)C2OC(CO)C(O)C12O |
| InChI | InChI=1S/C22H18N2O6/c25-10-16-18(27)22(29)19(30-16)21(13-9-23-14-7-3-1-5-11(13)14)17(26)12-6-2-4-8-15(12)24(21)20(22)28/h1-9,16,18-19,23,25,27,29H,10H2 |
| InChIKey | GESJIKYYEGPJJU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |