C15H26N4O3 — CID 7509718
5-[N-[2-(diethylamino)ethyl]-C-ethylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 7509718) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-[N-[2-(diethylamino)ethyl]-C-ethylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[N-[2-(diethylamino)ethyl]-C-ethylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7509718 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 5-[N-[2-(diethylamino)ethyl]-C-ethylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C(=N\CCN(CC)CC)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H26N4O3/c1-6-11(16-9-10-19(7-2)8-3)12-13(20)17(4)15(22)18(5)14(12)21/h12H,6-10H2,1-5H3/b16-11+ |
| InChIKey | RXTXHIXAQSMRIP-LFIBNONCSA-N |
| XLogP | 0.85 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|