C20H23F3N4O2 — CID 75120487
5-[4-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]piperidine-1-carbonyl]piperidin-2-one (PubChem CID 75120487) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 5-[4-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]piperidine-1-carbonyl]piperidin-2-one.
| Compound Name | 5-[4-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]piperidine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 75120487 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-[4-[[2-(trifluoromethyl)benzimidazol-1-yl]methyl]piperidine-1-carbonyl]piperidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCC(Cn3c(C(F)(F)F)nc4ccccc43)CC2)CN1 |
| InChI | InChI=1S/C20H23F3N4O2/c21-20(22,23)19-25-15-3-1-2-4-16(15)27(19)12-13-7-9-26(10-8-13)18(29)14-5-6-17(28)24-11-14/h1-4,13-14H,5-12H2,(H,24,28) |
| InChIKey | NLBGORWIMBGZPA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |