C21H30N6O2S — CID 75189548
2-(4-oxo-2-sulfanylidene-4a,5,6,7,8,8a-hexahydro-1H-pyrido[2,3-d]pyrimidin-3-yl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide (PubChem CID 75189548) has the molecular formula C21H30N6O2S and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-(4-oxo-2-sulfanylidene-4a,5,6,7,8,8a-hexahydro-1H-pyrido[2,3-d]pyrimidin-3-yl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-oxo-2-sulfanylidene-4a,5,6,7,8,8a-hexahydro-1H-pyrido[2,3-d]pyrimidin-3-yl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 75189548 |
| Molecular Formula | C21H30N6O2S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-(4-oxo-2-sulfanylidene-4a,5,6,7,8,8a-hexahydro-1H-pyrido[2,3-d]pyrimidin-3-yl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)C2CCCNC2NC1=S)NCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N6O2S/c28-18(15-27-20(29)17-7-4-8-23-19(17)24-21(27)30)22-9-10-25-11-13-26(14-12-25)16-5-2-1-3-6-16/h1-3,5-6,17,19,23H,4,7-15H2,(H,22,28)(H,24,30) |
| InChIKey | VEAHZIGSPZNHCY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|