C19H19ClN2O4S — CID 7521135
ethyl N-[2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carbonyl]carbamate (PubChem CID 7521135) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7521135 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | ethyl N-[2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1c(NC(=O)/C=C/c2ccccc2Cl)sc(C)c1C |
| InChI | InChI=1S/C19H19ClN2O4S/c1-4-26-19(25)22-17(24)16-11(2)12(3)27-18(16)21-15(23)10-9-13-7-5-6-8-14(13)20/h5-10H,4H2,1-3H3,(H,21,23)(H,22,24,25)/b10-9+ |
| InChIKey | WSALEYMMGYPIPC-MDZDMXLPSA-N |
| XLogP | 4.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|