C40H40O10 — CID 75213099
methyl 3,4,5-tribenzoyloxy-6-[2,6-di(propan-2-yl)phenoxy]oxane-2-carboxylate (PubChem CID 75213099) has the molecular formula C40H40O10 and a molecular weight of 680.75 g/mol. Its IUPAC name is methyl 3,4,5-tribenzoyloxy-6-[2,6-di(propan-2-yl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-tribenzoyloxy-6-[2,6-di(propan-2-yl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 75213099 |
| Molecular Formula | C40H40O10 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | methyl 3,4,5-tribenzoyloxy-6-[2,6-di(propan-2-yl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(Oc2c(C(C)C)cccc2C(C)C)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H40O10/c1-24(2)29-22-15-23-30(25(3)4)31(29)49-40-35(48-38(43)28-20-13-8-14-21-28)33(47-37(42)27-18-11-7-12-19-27)32(34(50-40)39(44)45-5)46-36(41)26-16-9-6-10-17-26/h6-25,32-35,40H,1-5H3 |
| InChIKey | GARPNTFZHJDPML-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|