C17H17FN3O4S- — CID 7524503
(2R,3R)-2-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-3-methylpentanoate (PubChem CID 7524503) has the molecular formula C17H17FN3O4S- and a molecular weight of 378.41 g/mol. Its IUPAC name is (2R,3R)-2-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-3-methylpentanoate.
| Compound Name | (2R,3R)-2-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 7524503 |
| Molecular Formula | C17H17FN3O4S- |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (2R,3R)-2-[[1-(4-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](/N=C/C1C(=O)NC(=S)N(c2ccc(F)cc2)C1=O)C(=O)[O-] |
| InChI | InChI=1S/C17H18FN3O4S/c1-3-9(2)13(16(24)25)19-8-12-14(22)20-17(26)21(15(12)23)11-6-4-10(18)5-7-11/h4-9,12-13H,3H2,1-2H3,(H,24,25)(H,20,22,26)/p-1/b19-8+/t9-,12?,13-/m1/s1 |
| InChIKey | GBJFDSMJDACRGL-AFVIPDTCSA-M |
| XLogP | 0.43 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|